C15H17F3O2 — CID 114971407
2-cyclohexyl-1-[3-(trifluoromethoxy)phenyl]ethanone (PubChem CID 114971407) has the molecular formula C15H17F3O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-cyclohexyl-1-[3-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 2-cyclohexyl-1-[3-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 114971407 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-cyclohexyl-1-[3-(trifluoromethoxy)phenyl]ethanone |
| SMILES | O=C(CC1CCCCC1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3O2/c16-15(17,18)20-13-8-4-7-12(10-13)14(19)9-11-5-2-1-3-6-11/h4,7-8,10-11H,1-3,5-6,9H2 |
| InChIKey | MEDRHGBZEBYJKP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |