C14H16F3NO2 — CID 116579967
(2-aminocyclohexyl)-[3-(trifluoromethoxy)phenyl]methanone (PubChem CID 116579967) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is (2-aminocyclohexyl)-[3-(trifluoromethoxy)phenyl]methanone.
| Compound Name | (2-aminocyclohexyl)-[3-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 116579967 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (2-aminocyclohexyl)-[3-(trifluoromethoxy)phenyl]methanone |
| SMILES | NC1CCCCC1C(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO2/c15-14(16,17)20-10-5-3-4-9(8-10)13(19)11-6-1-2-7-12(11)18/h3-5,8,11-12H,1-2,6-7,18H2 |
| InChIKey | WLULWFLKHDQFBI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |