C14H13F3O3 — CID 107104941
3-[3-(trifluoromethoxy)benzoyl]cyclohexan-1-one (PubChem CID 107104941) has the molecular formula C14H13F3O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is 3-[3-(trifluoromethoxy)benzoyl]cyclohexan-1-one.
| Compound Name | 3-[3-(trifluoromethoxy)benzoyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 107104941 |
| Molecular Formula | C14H13F3O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-[3-(trifluoromethoxy)benzoyl]cyclohexan-1-one |
| SMILES | O=C1CCCC(C(=O)c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H13F3O3/c15-14(16,17)20-12-6-2-4-10(8-12)13(19)9-3-1-5-11(18)7-9/h2,4,6,8-9H,1,3,5,7H2 |
| InChIKey | FMTSGNBWEZJDQG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |