C11H12F2OS — CID 130487424
2-(3,3-difluorocyclopentyl)-1-thiophen-3-ylethanone (PubChem CID 130487424) has the molecular formula C11H12F2OS and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-(3,3-difluorocyclopentyl)-1-thiophen-3-ylethanone.
| Compound Name | 2-(3,3-difluorocyclopentyl)-1-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 130487424 |
| Molecular Formula | C11H12F2OS |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-(3,3-difluorocyclopentyl)-1-thiophen-3-ylethanone |
| SMILES | O=C(CC1CCC(F)(F)C1)c1ccsc1 |
| InChI | InChI=1S/C11H12F2OS/c12-11(13)3-1-8(6-11)5-10(14)9-2-4-15-7-9/h2,4,7-8H,1,3,5-6H2 |
| InChIKey | DRJDPSLBIJIKBS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |