C11H15NOS — CID 116564139
2-piperidin-3-yl-1-thiophen-3-ylethanone (PubChem CID 116564139) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-piperidin-3-yl-1-thiophen-3-ylethanone.
| Compound Name | 2-piperidin-3-yl-1-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 116564139 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-piperidin-3-yl-1-thiophen-3-ylethanone |
| SMILES | O=C(CC1CCCNC1)c1ccsc1 |
| InChI | InChI=1S/C11H15NOS/c13-11(10-3-5-14-8-10)6-9-2-1-4-12-7-9/h3,5,8-9,12H,1-2,4,6-7H2 |
| InChIKey | BTWYYDYWZKORLO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |