C10H14N2OS — CID 71645364
N-[(3S)-piperidin-3-yl]thiophene-3-carboxamide (PubChem CID 71645364) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is N-[(3S)-piperidin-3-yl]thiophene-3-carboxamide.
| Compound Name | N-[(3S)-piperidin-3-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 71645364 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N-[(3S)-piperidin-3-yl]thiophene-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCNC1)c1ccsc1 |
| InChI | InChI=1S/C10H14N2OS/c13-10(8-3-5-14-7-8)12-9-2-1-4-11-6-9/h3,5,7,9,11H,1-2,4,6H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | BVWAQLVGMUMDIZ-VIFPVBQESA-N |
| XLogP | 1.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |