C11H14N2O2 — CID 79689032
4-hydroxy-N-[(3S)-pyrrolidin-3-yl]benzamide (PubChem CID 79689032) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-hydroxy-N-[(3S)-pyrrolidin-3-yl]benzamide.
| Compound Name | 4-hydroxy-N-[(3S)-pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 79689032 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-hydroxy-N-[(3S)-pyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCNC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N2O2/c14-10-3-1-8(2-4-10)11(15)13-9-5-6-12-7-9/h1-4,9,12,14H,5-7H2,(H,13,15)/t9-/m0/s1 |
| InChIKey | NYQNDEWOFNANED-VIFPVBQESA-N |
| XLogP | 0.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |