C11H14N2O3 — CID 107728777
3,4-dihydroxy-N-[(3S)-pyrrolidin-3-yl]benzamide (PubChem CID 107728777) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 3,4-dihydroxy-N-[(3S)-pyrrolidin-3-yl]benzamide.
| Compound Name | 3,4-dihydroxy-N-[(3S)-pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 107728777 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3,4-dihydroxy-N-[(3S)-pyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCNC1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H14N2O3/c14-9-2-1-7(5-10(9)15)11(16)13-8-3-4-12-6-8/h1-2,5,8,12,14-15H,3-4,6H2,(H,13,16)/t8-/m0/s1 |
| InChIKey | YDCRWRZKAIILJT-QMMMGPOBSA-N |
| XLogP | 0.19 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|