C11H12ClIN2O — CID 103209637
3-chloro-4-iodo-N-[(3R)-pyrrolidin-3-yl]benzamide (PubChem CID 103209637) has the molecular formula C11H12ClIN2O and a molecular weight of 350.59 g/mol. Its IUPAC name is 3-chloro-4-iodo-N-[(3R)-pyrrolidin-3-yl]benzamide.
| Compound Name | 3-chloro-4-iodo-N-[(3R)-pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 103209637 |
| Molecular Formula | C11H12ClIN2O |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 3-chloro-4-iodo-N-[(3R)-pyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCNC1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClIN2O/c12-9-5-7(1-2-10(9)13)11(16)15-8-3-4-14-6-8/h1-2,5,8,14H,3-4,6H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | JQSCYXQYDJMFGN-MRVPVSSYSA-N |
| XLogP | 2.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|