C8H10N2OS — CID 66187231
N-(azetidin-3-yl)thiophene-3-carboxamide (PubChem CID 66187231) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is N-(azetidin-3-yl)thiophene-3-carboxamide.
| Compound Name | N-(azetidin-3-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 66187231 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | N-(azetidin-3-yl)thiophene-3-carboxamide |
| SMILES | O=C(NC1CNC1)c1ccsc1 |
| InChI | InChI=1S/C8H10N2OS/c11-8(6-1-2-12-5-6)10-7-3-9-4-7/h1-2,5,7,9H,3-4H2,(H,10,11) |
| InChIKey | UCTOTQLTXBQYEV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |