C9H10N2O2S — CID 95985002
N-[(3R)-5-oxopyrrolidin-3-yl]thiophene-3-carboxamide (PubChem CID 95985002) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is N-[(3R)-5-oxopyrrolidin-3-yl]thiophene-3-carboxamide.
| Compound Name | N-[(3R)-5-oxopyrrolidin-3-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 95985002 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | N-[(3R)-5-oxopyrrolidin-3-yl]thiophene-3-carboxamide |
| SMILES | O=C1C[C@@H](NC(=O)c2ccsc2)CN1 |
| InChI | InChI=1S/C9H10N2O2S/c12-8-3-7(4-10-8)11-9(13)6-1-2-14-5-6/h1-2,5,7H,3-4H2,(H,10,12)(H,11,13)/t7-/m1/s1 |
| InChIKey | FPSWNKMGJQGJIL-SSDOTTSWSA-N |
| XLogP | 0.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |