C12H11F3N2O3 — CID 71789114
N-(5-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 71789114) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.23 g/mol. Its IUPAC name is N-(5-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(5-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 71789114 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-(5-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | O=C1CC(NC(=O)c2ccc(OC(F)(F)F)cc2)CN1 |
| InChI | InChI=1S/C12H11F3N2O3/c13-12(14,15)20-9-3-1-7(2-4-9)11(19)17-8-5-10(18)16-6-8/h1-4,8H,5-6H2,(H,16,18)(H,17,19) |
| InChIKey | HKXWDJGHPXHQBB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |