C13H14N2O4 — CID 95984956
methyl 4-[[(3R)-5-oxopyrrolidin-3-yl]carbamoyl]benzoate (PubChem CID 95984956) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 4-[[(3R)-5-oxopyrrolidin-3-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[(3R)-5-oxopyrrolidin-3-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 95984956 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 4-[[(3R)-5-oxopyrrolidin-3-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N[C@H]2CNC(=O)C2)cc1 |
| InChI | InChI=1S/C13H14N2O4/c1-19-13(18)9-4-2-8(3-5-9)12(17)15-10-6-11(16)14-7-10/h2-5,10H,6-7H2,1H3,(H,14,16)(H,15,17)/t10-/m1/s1 |
| InChIKey | LYVFGRSNVSIWAU-SNVBAGLBSA-N |
| XLogP | 0.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |