C14H16N2O2 — CID 112534753
N-(5-oxopyrrolidin-3-yl)-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 112534753) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-(5-oxopyrrolidin-3-yl)-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-(5-oxopyrrolidin-3-yl)-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 112534753 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-(5-oxopyrrolidin-3-yl)-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | O=C1CC(NC(=O)c2ccc3c(c2)CCC3)CN1 |
| InChI | InChI=1S/C14H16N2O2/c17-13-7-12(8-15-13)16-14(18)11-5-4-9-2-1-3-10(9)6-11/h4-6,12H,1-3,7-8H2,(H,15,17)(H,16,18) |
| InChIKey | NDJFNDKTEATAGK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |