C11H15NOS — CID 116578647
2-(1-aminocyclopentyl)-1-thiophen-3-ylethanone (PubChem CID 116578647) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-(1-aminocyclopentyl)-1-thiophen-3-ylethanone.
| Compound Name | 2-(1-aminocyclopentyl)-1-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 116578647 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-(1-aminocyclopentyl)-1-thiophen-3-ylethanone |
| SMILES | NC1(CC(=O)c2ccsc2)CCCC1 |
| InChI | InChI=1S/C11H15NOS/c12-11(4-1-2-5-11)7-10(13)9-3-6-14-8-9/h3,6,8H,1-2,4-5,7,12H2 |
| InChIKey | HQHVFRATNCJUBN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |