C11H14ClNOS — CID 114300617
N-[1-(chloromethyl)cyclopentyl]thiophene-3-carboxamide (PubChem CID 114300617) has the molecular formula C11H14ClNOS and a molecular weight of 243.76 g/mol. Its IUPAC name is N-[1-(chloromethyl)cyclopentyl]thiophene-3-carboxamide.
| Compound Name | N-[1-(chloromethyl)cyclopentyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 114300617 |
| Molecular Formula | C11H14ClNOS |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-[1-(chloromethyl)cyclopentyl]thiophene-3-carboxamide |
| SMILES | O=C(NC1(CCl)CCCC1)c1ccsc1 |
| InChI | InChI=1S/C11H14ClNOS/c12-8-11(4-1-2-5-11)13-10(14)9-3-6-15-7-9/h3,6-7H,1-2,4-5,8H2,(H,13,14) |
| InChIKey | XNHMJMHQIWFKDO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|