C13H14Cl3NO — CID 114300519
2,6-dichloro-N-[1-(chloromethyl)cyclopentyl]benzamide (PubChem CID 114300519) has the molecular formula C13H14Cl3NO and a molecular weight of 306.62 g/mol. Its IUPAC name is 2,6-dichloro-N-[1-(chloromethyl)cyclopentyl]benzamide.
| Compound Name | 2,6-dichloro-N-[1-(chloromethyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 114300519 |
| Molecular Formula | C13H14Cl3NO |
| Molecular Weight | 306.62 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2,6-dichloro-N-[1-(chloromethyl)cyclopentyl]benzamide |
| SMILES | O=C(NC1(CCl)CCCC1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H14Cl3NO/c14-8-13(6-1-2-7-13)17-12(18)11-9(15)4-3-5-10(11)16/h3-5H,1-2,6-8H2,(H,17,18) |
| InChIKey | LXGRYARHOVJEOI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|