C14H16Cl2N2OS — CID 61118938
N-(1-carbamothioylcyclohexyl)-2,6-dichlorobenzamide (PubChem CID 61118938) has the molecular formula C14H16Cl2N2OS and a molecular weight of 331.27 g/mol. Its IUPAC name is N-(1-carbamothioylcyclohexyl)-2,6-dichlorobenzamide.
| Compound Name | N-(1-carbamothioylcyclohexyl)-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 61118938 |
| Molecular Formula | C14H16Cl2N2OS |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-(1-carbamothioylcyclohexyl)-2,6-dichlorobenzamide |
| SMILES | NC(=S)C1(NC(=O)c2c(Cl)cccc2Cl)CCCCC1 |
| InChI | InChI=1S/C14H16Cl2N2OS/c15-9-5-4-6-10(16)11(9)12(19)18-14(13(17)20)7-2-1-3-8-14/h4-6H,1-3,7-8H2,(H2,17,20)(H,18,19) |
| InChIKey | RIQIRLXXINXOHA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|