C13H14BrClN2OS — CID 61118936
4-bromo-N-(1-carbamothioylcyclopentyl)-2-chlorobenzamide (PubChem CID 61118936) has the molecular formula C13H14BrClN2OS and a molecular weight of 361.69 g/mol. Its IUPAC name is 4-bromo-N-(1-carbamothioylcyclopentyl)-2-chlorobenzamide.
| Compound Name | 4-bromo-N-(1-carbamothioylcyclopentyl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 61118936 |
| Molecular Formula | C13H14BrClN2OS |
| Molecular Weight | 361.69 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 4-bromo-N-(1-carbamothioylcyclopentyl)-2-chlorobenzamide |
| SMILES | NC(=S)C1(NC(=O)c2ccc(Br)cc2Cl)CCCC1 |
| InChI | InChI=1S/C13H14BrClN2OS/c14-8-3-4-9(10(15)7-8)11(18)17-13(12(16)19)5-1-2-6-13/h3-4,7H,1-2,5-6H2,(H2,16,19)(H,17,18) |
| InChIKey | INJHFBOGXNUNTB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|