C14H15ClF2N2OS — CID 82772161
N-(1-carbamothioylcyclohexyl)-4-chloro-2,5-difluorobenzamide (PubChem CID 82772161) has the molecular formula C14H15ClF2N2OS and a molecular weight of 332.80 g/mol. Its IUPAC name is N-(1-carbamothioylcyclohexyl)-4-chloro-2,5-difluorobenzamide.
| Compound Name | N-(1-carbamothioylcyclohexyl)-4-chloro-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 82772161 |
| Molecular Formula | C14H15ClF2N2OS |
| Molecular Weight | 332.80 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-(1-carbamothioylcyclohexyl)-4-chloro-2,5-difluorobenzamide |
| SMILES | NC(=S)C1(NC(=O)c2cc(F)c(Cl)cc2F)CCCCC1 |
| InChI | InChI=1S/C14H15ClF2N2OS/c15-9-7-10(16)8(6-11(9)17)12(20)19-14(13(18)21)4-2-1-3-5-14/h6-7H,1-5H2,(H2,18,21)(H,19,20) |
| InChIKey | TTYWUHGNFPCDPC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.80 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|