C13H14F2N2OS — CID 61119914
N-(1-carbamothioylcyclopentyl)-3,5-difluorobenzamide (PubChem CID 61119914) has the molecular formula C13H14F2N2OS and a molecular weight of 284.33 g/mol. Its IUPAC name is N-(1-carbamothioylcyclopentyl)-3,5-difluorobenzamide.
| Compound Name | N-(1-carbamothioylcyclopentyl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 61119914 |
| Molecular Formula | C13H14F2N2OS |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(1-carbamothioylcyclopentyl)-3,5-difluorobenzamide |
| SMILES | NC(=S)C1(NC(=O)c2cc(F)cc(F)c2)CCCC1 |
| InChI | InChI=1S/C13H14F2N2OS/c14-9-5-8(6-10(15)7-9)11(18)17-13(12(16)19)3-1-2-4-13/h5-7H,1-4H2,(H2,16,19)(H,17,18) |
| InChIKey | YZPGJSDASKZOJQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|