1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid

C11H9F2NO3 — CID 65450763

IUPAC1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid
SMILESO=C(NC1(C(=O)O)CC1)c1cc(F)cc(F)c1
InChIInChI=1S/C11H9F2NO3/c12-7-3-6(4-8(13)5-7)9(15)14-11(1-2-11)10(16)17/h3-5H,1-2H2,(H,14,15)(H,16,17)
InChIKeyJBLVVQVYDWXAPT-UHFFFAOYSA-N
MW241.19 g/mol
LogP1.31
Rot. Bonds3

About 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid

1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid (PubChem CID 65450763) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid
PubChem CID65450763
Molecular FormulaC11H9F2NO3
Molecular Weight241.19 g/mol
Exact Mass241.06
IUPAC Name1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid
SMILESO=C(NC1(C(=O)O)CC1)c1cc(F)cc(F)c1
InChIInChI=1S/C11H9F2NO3/c12-7-3-6(4-8(13)5-7)9(15)14-11(1-2-11)10(16)17/h3-5H,1-2H2,(H,14,15)(H,16,17)
InChIKeyJBLVVQVYDWXAPT-UHFFFAOYSA-N
XLogP1.31
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.19
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid?
The IUPAC name of 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid (CID 65450763) is 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid is O=C(NC1(C(=O)O)CC1)c1cc(F)cc(F)c1.
What is the InChIKey of 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid?
The InChIKey is JBLVVQVYDWXAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO3/c12-7-3-6(4-8(13)5-7)9(15)14-11(1-2-11)10(16)17/h3-5H,1-2H2,(H,14,15)(H,16,17).
What are the key properties of 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid?
1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid has a molecular weight of 241.19 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-difluorobenzoyl)amino]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 65450763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).