C13H13F3N2OS — CID 79749223
N-(1-carbamothioylcyclopentyl)-2,3,4-trifluorobenzamide (PubChem CID 79749223) has the molecular formula C13H13F3N2OS and a molecular weight of 302.32 g/mol. Its IUPAC name is N-(1-carbamothioylcyclopentyl)-2,3,4-trifluorobenzamide.
| Compound Name | N-(1-carbamothioylcyclopentyl)-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 79749223 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-(1-carbamothioylcyclopentyl)-2,3,4-trifluorobenzamide |
| SMILES | NC(=S)C1(NC(=O)c2ccc(F)c(F)c2F)CCCC1 |
| InChI | InChI=1S/C13H13F3N2OS/c14-8-4-3-7(9(15)10(8)16)11(19)18-13(12(17)20)5-1-2-6-13/h3-4H,1-2,5-6H2,(H2,17,20)(H,18,19) |
| InChIKey | DGFDBDYLPDUHKZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|