C15H18F2N2OS — CID 61121738
N-(1-carbamothioyl-4-methylcyclohexyl)-2,4-difluorobenzamide (PubChem CID 61121738) has the molecular formula C15H18F2N2OS and a molecular weight of 312.38 g/mol. Its IUPAC name is N-(1-carbamothioyl-4-methylcyclohexyl)-2,4-difluorobenzamide.
| Compound Name | N-(1-carbamothioyl-4-methylcyclohexyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 61121738 |
| Molecular Formula | C15H18F2N2OS |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(1-carbamothioyl-4-methylcyclohexyl)-2,4-difluorobenzamide |
| SMILES | CC1CCC(NC(=O)c2ccc(F)cc2F)(C(N)=S)CC1 |
| InChI | InChI=1S/C15H18F2N2OS/c1-9-4-6-15(7-5-9,14(18)21)19-13(20)11-3-2-10(16)8-12(11)17/h2-3,8-9H,4-7H2,1H3,(H2,18,21)(H,19,20) |
| InChIKey | SPVSQTQARWFAKH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|