C14H18FN3OS — CID 64949883
N-(1-carbamothioyl-4-methylcyclohexyl)-3-fluoropyridine-4-carboxamide (PubChem CID 64949883) has the molecular formula C14H18FN3OS and a molecular weight of 295.38 g/mol. Its IUPAC name is N-(1-carbamothioyl-4-methylcyclohexyl)-3-fluoropyridine-4-carboxamide.
| Compound Name | N-(1-carbamothioyl-4-methylcyclohexyl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 64949883 |
| Molecular Formula | C14H18FN3OS |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(1-carbamothioyl-4-methylcyclohexyl)-3-fluoropyridine-4-carboxamide |
| SMILES | CC1CCC(NC(=O)c2ccncc2F)(C(N)=S)CC1 |
| InChI | InChI=1S/C14H18FN3OS/c1-9-2-5-14(6-3-9,13(16)20)18-12(19)10-4-7-17-8-11(10)15/h4,7-9H,2-3,5-6H2,1H3,(H2,16,20)(H,18,19) |
| InChIKey | QQACYKAKVDCDKW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|