C15H18ClF2NO — CID 114304359
N-[1-(chloromethyl)-4-methylcyclohexyl]-2,4-difluorobenzamide (PubChem CID 114304359) has the molecular formula C15H18ClF2NO and a molecular weight of 301.76 g/mol. Its IUPAC name is N-[1-(chloromethyl)-4-methylcyclohexyl]-2,4-difluorobenzamide.
| Compound Name | N-[1-(chloromethyl)-4-methylcyclohexyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 114304359 |
| Molecular Formula | C15H18ClF2NO |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[1-(chloromethyl)-4-methylcyclohexyl]-2,4-difluorobenzamide |
| SMILES | CC1CCC(CCl)(NC(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H18ClF2NO/c1-10-4-6-15(9-16,7-5-10)19-14(20)12-3-2-11(17)8-13(12)18/h2-3,8,10H,4-7,9H2,1H3,(H,19,20) |
| InChIKey | ODTRLWNRBJFVAY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|