C15H19Cl2NO2 — CID 106503135
2-chloro-N-[1-(chloromethyl)-4-methylcyclohexyl]-5-hydroxybenzamide (PubChem CID 106503135) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-chloro-N-[1-(chloromethyl)-4-methylcyclohexyl]-5-hydroxybenzamide.
| Compound Name | 2-chloro-N-[1-(chloromethyl)-4-methylcyclohexyl]-5-hydroxybenzamide |
|---|---|
| PubChem CID | 106503135 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-chloro-N-[1-(chloromethyl)-4-methylcyclohexyl]-5-hydroxybenzamide |
| SMILES | CC1CCC(CCl)(NC(=O)c2cc(O)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-10-4-6-15(9-16,7-5-10)18-14(20)12-8-11(19)2-3-13(12)17/h2-3,8,10,19H,4-7,9H2,1H3,(H,18,20) |
| InChIKey | HNPCXBCVDZPLSU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|