About N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide
N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide (PubChem CID 107726347) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide.
Molecular Properties
| Compound Name | N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide |
| PubChem CID | 107726347 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide |
| SMILES | CC1CCC(CN)(NC(=O)c2ccc(O)cc2O)CC1 |
| InChI | InChI=1S/C15H22N2O3/c1-10-4-6-15(9-16,7-5-10)17-14(20)12-3-2-11(18)8-13(12)19/h2-3,8,10,18-19H,4-7,9,16H2,1H3,(H,17,20) |
| InChIKey | ZAOVKMHAXLUXHH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide?
The IUPAC name of N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide (CID 107726347) is N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide.
What is the SMILES notation for N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide?
The canonical SMILES for N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide is CC1CCC(CN)(NC(=O)c2ccc(O)cc2O)CC1.
What is the InChIKey of N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide?
The InChIKey is ZAOVKMHAXLUXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-10-4-6-15(9-16,7-5-10)17-14(20)12-3-2-11(18)8-13(12)19/h2-3,8,10,18-19H,4-7,9,16H2,1H3,(H,17,20).
What are the key properties of N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide?
N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide has a molecular weight of 278.35 g/mol, XLogP of 1.74, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(aminomethyl)-4-methylcyclohexyl]-2,4-dihydroxybenzamide is sourced from PubChem (CID 107726347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).