C11H14N2O3 — CID 107726425
N-[1-(aminomethyl)cyclopropyl]-2,5-dihydroxybenzamide (PubChem CID 107726425) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopropyl]-2,5-dihydroxybenzamide.
| Compound Name | N-[1-(aminomethyl)cyclopropyl]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107726425 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-[1-(aminomethyl)cyclopropyl]-2,5-dihydroxybenzamide |
| SMILES | NCC1(NC(=O)c2cc(O)ccc2O)CC1 |
| InChI | InChI=1S/C11H14N2O3/c12-6-11(3-4-11)13-10(16)8-5-7(14)1-2-9(8)15/h1-2,5,14-15H,3-4,6,12H2,(H,13,16) |
| InChIKey | HKVVCQYUKNZEFI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|