C13H17NO5 — CID 106297310
2,5-dihydroxy-N-[4-(hydroxymethyl)oxan-4-yl]benzamide (PubChem CID 106297310) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2,5-dihydroxy-N-[4-(hydroxymethyl)oxan-4-yl]benzamide.
| Compound Name | 2,5-dihydroxy-N-[4-(hydroxymethyl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 106297310 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2,5-dihydroxy-N-[4-(hydroxymethyl)oxan-4-yl]benzamide |
| SMILES | O=C(NC1(CO)CCOCC1)c1cc(O)ccc1O |
| InChI | InChI=1S/C13H17NO5/c15-8-13(3-5-19-6-4-13)14-12(18)10-7-9(16)1-2-11(10)17/h1-2,7,15-17H,3-6,8H2,(H,14,18) |
| InChIKey | PMGOVZNCVKGIEP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|