C11H14BrNO4 — CID 107091848
2-bromo-N-[4-(hydroxymethyl)oxan-4-yl]furan-3-carboxamide (PubChem CID 107091848) has the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. Its IUPAC name is 2-bromo-N-[4-(hydroxymethyl)oxan-4-yl]furan-3-carboxamide.
| Compound Name | 2-bromo-N-[4-(hydroxymethyl)oxan-4-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 107091848 |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-bromo-N-[4-(hydroxymethyl)oxan-4-yl]furan-3-carboxamide |
| SMILES | O=C(NC1(CO)CCOCC1)c1ccoc1Br |
| InChI | InChI=1S/C11H14BrNO4/c12-9-8(1-4-17-9)10(15)13-11(7-14)2-5-16-6-3-11/h1,4,14H,2-3,5-7H2,(H,13,15) |
| InChIKey | KSDXXXMXZSHGAX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |