C10H14N2O4 — CID 103954215
N-[4-(hydroxymethyl)oxan-4-yl]-1,2-oxazole-3-carboxamide (PubChem CID 103954215) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)oxan-4-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[4-(hydroxymethyl)oxan-4-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 103954215 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N-[4-(hydroxymethyl)oxan-4-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1(CO)CCOCC1)c1ccon1 |
| InChI | InChI=1S/C10H14N2O4/c13-7-10(2-5-15-6-3-10)11-9(14)8-1-4-16-12-8/h1,4,13H,2-3,5-7H2,(H,11,14) |
| InChIKey | YMHJBFSEWUUDSU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |