C11H12BrNO3 — CID 107726184
N-[1-(bromomethyl)cyclopropyl]-2,5-dihydroxybenzamide (PubChem CID 107726184) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is N-[1-(bromomethyl)cyclopropyl]-2,5-dihydroxybenzamide.
| Compound Name | N-[1-(bromomethyl)cyclopropyl]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107726184 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | N-[1-(bromomethyl)cyclopropyl]-2,5-dihydroxybenzamide |
| SMILES | O=C(NC1(CBr)CC1)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H12BrNO3/c12-6-11(3-4-11)13-10(16)8-5-7(14)1-2-9(8)15/h1-2,5,14-15H,3-4,6H2,(H,13,16) |
| InChIKey | GYYPLCVNMNMMMW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|