C9H8Br3NOS — CID 107966316
2,5-dibromo-N-[1-(bromomethyl)cyclopropyl]thiophene-3-carboxamide (PubChem CID 107966316) has the molecular formula C9H8Br3NOS and a molecular weight of 417.95 g/mol. Its IUPAC name is 2,5-dibromo-N-[1-(bromomethyl)cyclopropyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[1-(bromomethyl)cyclopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107966316 |
| Molecular Formula | C9H8Br3NOS |
| Molecular Weight | 417.95 g/mol |
| Exact Mass | 414.79 |
| IUPAC Name | 2,5-dibromo-N-[1-(bromomethyl)cyclopropyl]thiophene-3-carboxamide |
| SMILES | O=C(NC1(CBr)CC1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H8Br3NOS/c10-4-9(1-2-9)13-8(14)5-3-6(11)15-7(5)12/h3H,1-2,4H2,(H,13,14) |
| InChIKey | NYXPBOGPFBFANQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.95 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|