C14H20N2O3 — CID 107726341
N-[1-(aminomethyl)cyclohexyl]-2,4-dihydroxybenzamide (PubChem CID 107726341) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclohexyl]-2,4-dihydroxybenzamide.
| Compound Name | N-[1-(aminomethyl)cyclohexyl]-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 107726341 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[1-(aminomethyl)cyclohexyl]-2,4-dihydroxybenzamide |
| SMILES | NCC1(NC(=O)c2ccc(O)cc2O)CCCCC1 |
| InChI | InChI=1S/C14H20N2O3/c15-9-14(6-2-1-3-7-14)16-13(19)11-5-4-10(17)8-12(11)18/h4-5,8,17-18H,1-3,6-7,9,15H2,(H,16,19) |
| InChIKey | LIUFLZNTWOZBGS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |