C15H18Cl2FNO — CID 82879015
3-chloro-N-[1-(chloromethyl)-4-methylcyclohexyl]-4-fluorobenzamide (PubChem CID 82879015) has the molecular formula C15H18Cl2FNO and a molecular weight of 318.22 g/mol. Its IUPAC name is 3-chloro-N-[1-(chloromethyl)-4-methylcyclohexyl]-4-fluorobenzamide.
| Compound Name | 3-chloro-N-[1-(chloromethyl)-4-methylcyclohexyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 82879015 |
| Molecular Formula | C15H18Cl2FNO |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-chloro-N-[1-(chloromethyl)-4-methylcyclohexyl]-4-fluorobenzamide |
| SMILES | CC1CCC(CCl)(NC(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18Cl2FNO/c1-10-4-6-15(9-16,7-5-10)19-14(20)11-2-3-13(18)12(17)8-11/h2-3,8,10H,4-7,9H2,1H3,(H,19,20) |
| InChIKey | LJLWXWQMRXPAKW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|