C15H20ClNO2 — CID 62527858
3-chloro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide (PubChem CID 62527858) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 3-chloro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide.
| Compound Name | 3-chloro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 62527858 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-chloro-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide |
| SMILES | CC1CCC(CO)(NC(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H20ClNO2/c1-11-5-7-15(10-18,8-6-11)17-14(19)12-3-2-4-13(16)9-12/h2-4,9,11,18H,5-8,10H2,1H3,(H,17,19) |
| InChIKey | QPGUOTHGUXKIRG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |