C17H23NO3 — CID 86791516
4-acetyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide (PubChem CID 86791516) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-acetyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide.
| Compound Name | 4-acetyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 86791516 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 4-acetyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]benzamide |
| SMILES | CC(=O)c1ccc(C(=O)NC2(CO)CCC(C)CC2)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-12-7-9-17(11-19,10-8-12)18-16(21)15-5-3-14(4-6-15)13(2)20/h3-6,12,19H,7-11H2,1-2H3,(H,18,21) |
| InChIKey | GUTDBWRCYMUMLJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |