C13H15ClFNO3 — CID 114170563
N-[4-(chloromethyl)oxan-4-yl]-4-fluoro-2-hydroxybenzamide (PubChem CID 114170563) has the molecular formula C13H15ClFNO3 and a molecular weight of 287.72 g/mol. Its IUPAC name is N-[4-(chloromethyl)oxan-4-yl]-4-fluoro-2-hydroxybenzamide.
| Compound Name | N-[4-(chloromethyl)oxan-4-yl]-4-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 114170563 |
| Molecular Formula | C13H15ClFNO3 |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-[4-(chloromethyl)oxan-4-yl]-4-fluoro-2-hydroxybenzamide |
| SMILES | O=C(NC1(CCl)CCOCC1)c1ccc(F)cc1O |
| InChI | InChI=1S/C13H15ClFNO3/c14-8-13(3-5-19-6-4-13)16-12(18)10-2-1-9(15)7-11(10)17/h1-2,7,17H,3-6,8H2,(H,16,18) |
| InChIKey | FUFFLWNJDANXKO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|