C12H10ClF2NO4 — CID 82783105
3-[(4-chloro-2,5-difluorobenzoyl)amino]oxolane-3-carboxylic acid (PubChem CID 82783105) has the molecular formula C12H10ClF2NO4 and a molecular weight of 305.66 g/mol. Its IUPAC name is 3-[(4-chloro-2,5-difluorobenzoyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[(4-chloro-2,5-difluorobenzoyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 82783105 |
| Molecular Formula | C12H10ClF2NO4 |
| Molecular Weight | 305.66 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 3-[(4-chloro-2,5-difluorobenzoyl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCOC1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H10ClF2NO4/c13-7-4-8(14)6(3-9(7)15)10(17)16-12(11(18)19)1-2-20-5-12/h3-4H,1-2,5H2,(H,16,17)(H,18,19) |
| InChIKey | BPUUSTCZBWMQLY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.66 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|