C12H11FINO4 — CID 113352905
3-[(4-fluoro-2-iodobenzoyl)amino]oxolane-3-carboxylic acid (PubChem CID 113352905) has the molecular formula C12H11FINO4 and a molecular weight of 379.13 g/mol. Its IUPAC name is 3-[(4-fluoro-2-iodobenzoyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[(4-fluoro-2-iodobenzoyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 113352905 |
| Molecular Formula | C12H11FINO4 |
| Molecular Weight | 379.13 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 3-[(4-fluoro-2-iodobenzoyl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCOC1)c1ccc(F)cc1I |
| InChI | InChI=1S/C12H11FINO4/c13-7-1-2-8(9(14)5-7)10(16)15-12(11(17)18)3-4-19-6-12/h1-2,5H,3-4,6H2,(H,15,16)(H,17,18) |
| InChIKey | BHRDIYWHHSDTLD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.13 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|