C12H11ClINO4 — CID 103925892
3-[(5-chloro-2-iodobenzoyl)amino]oxolane-3-carboxylic acid (PubChem CID 103925892) has the molecular formula C12H11ClINO4 and a molecular weight of 395.58 g/mol. Its IUPAC name is 3-[(5-chloro-2-iodobenzoyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[(5-chloro-2-iodobenzoyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 103925892 |
| Molecular Formula | C12H11ClINO4 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 394.94 |
| IUPAC Name | 3-[(5-chloro-2-iodobenzoyl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCOC1)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C12H11ClINO4/c13-7-1-2-9(14)8(5-7)10(16)15-12(11(17)18)3-4-19-6-12/h1-2,5H,3-4,6H2,(H,15,16)(H,17,18) |
| InChIKey | BGGIOAZBSDSJJY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|