C15H13FN2O4 — CID 120532730
3-[(6-fluoroquinoline-8-carbonyl)amino]oxolane-3-carboxylic acid (PubChem CID 120532730) has the molecular formula C15H13FN2O4 and a molecular weight of 304.28 g/mol. Its IUPAC name is 3-[(6-fluoroquinoline-8-carbonyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[(6-fluoroquinoline-8-carbonyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 120532730 |
| Molecular Formula | C15H13FN2O4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3-[(6-fluoroquinoline-8-carbonyl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCOC1)c1cc(F)cc2cccnc12 |
| InChI | InChI=1S/C15H13FN2O4/c16-10-6-9-2-1-4-17-12(9)11(7-10)13(19)18-15(14(20)21)3-5-22-8-15/h1-2,4,6-7H,3,5,8H2,(H,18,19)(H,20,21) |
| InChIKey | SAMWLAISMQFRSC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |