C13H12ClF2NO4 — CID 115291756
4-[(2-chloro-4,5-difluorobenzoyl)amino]oxane-4-carboxylic acid (PubChem CID 115291756) has the molecular formula C13H12ClF2NO4 and a molecular weight of 319.69 g/mol. Its IUPAC name is 4-[(2-chloro-4,5-difluorobenzoyl)amino]oxane-4-carboxylic acid.
| Compound Name | 4-[(2-chloro-4,5-difluorobenzoyl)amino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115291756 |
| Molecular Formula | C13H12ClF2NO4 |
| Molecular Weight | 319.69 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-[(2-chloro-4,5-difluorobenzoyl)amino]oxane-4-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCOCC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H12ClF2NO4/c14-8-6-10(16)9(15)5-7(8)11(18)17-13(12(19)20)1-3-21-4-2-13/h5-6H,1-4H2,(H,17,18)(H,19,20) |
| InChIKey | MSXDUQQJJWJIEQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.69 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|