C13H12I3NO4 — CID 115291763
4-[(2,3,5-triiodobenzoyl)amino]oxane-4-carboxylic acid (PubChem CID 115291763) has the molecular formula C13H12I3NO4 and a molecular weight of 626.95 g/mol. Its IUPAC name is 4-[(2,3,5-triiodobenzoyl)amino]oxane-4-carboxylic acid.
| Compound Name | 4-[(2,3,5-triiodobenzoyl)amino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115291763 |
| Molecular Formula | C13H12I3NO4 |
| Molecular Weight | 626.95 g/mol |
| Exact Mass | 626.79 |
| IUPAC Name | 4-[(2,3,5-triiodobenzoyl)amino]oxane-4-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCOCC1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C13H12I3NO4/c14-7-5-8(10(16)9(15)6-7)11(18)17-13(12(19)20)1-3-21-4-2-13/h5-6H,1-4H2,(H,17,18)(H,19,20) |
| InChIKey | CGEDDDSWPPVWMM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.95 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|