C14H16I3NO3 — CID 114951412
N-[(4-hydroxyoxan-4-yl)methyl]-2,3,5-triiodo-N-methylbenzamide (PubChem CID 114951412) has the molecular formula C14H16I3NO3 and a molecular weight of 627.00 g/mol. Its IUPAC name is N-[(4-hydroxyoxan-4-yl)methyl]-2,3,5-triiodo-N-methylbenzamide.
| Compound Name | N-[(4-hydroxyoxan-4-yl)methyl]-2,3,5-triiodo-N-methylbenzamide |
|---|---|
| PubChem CID | 114951412 |
| Molecular Formula | C14H16I3NO3 |
| Molecular Weight | 627.00 g/mol |
| Exact Mass | 626.83 |
| IUPAC Name | N-[(4-hydroxyoxan-4-yl)methyl]-2,3,5-triiodo-N-methylbenzamide |
| SMILES | CN(CC1(O)CCOCC1)C(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C14H16I3NO3/c1-18(8-14(20)2-4-21-5-3-14)13(19)10-6-9(15)7-11(16)12(10)17/h6-7,20H,2-5,8H2,1H3 |
| InChIKey | RNRWVSYJOJITNL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.00 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|