C14H19NO5 — CID 105339952
3,5-dihydroxy-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzamide (PubChem CID 105339952) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzamide.
| Compound Name | 3,5-dihydroxy-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 105339952 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3,5-dihydroxy-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzamide |
| SMILES | CN(CC1(O)CCOCC1)C(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H19NO5/c1-15(9-14(19)2-4-20-5-3-14)13(18)10-6-11(16)8-12(17)7-10/h6-8,16-17,19H,2-5,9H2,1H3 |
| InChIKey | STFCXBDDHXUNJO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |