C14H17ClINO3 — CID 105341207
3-chloro-N-[(4-hydroxyoxan-4-yl)methyl]-4-iodo-N-methylbenzamide (PubChem CID 105341207) has the molecular formula C14H17ClINO3 and a molecular weight of 409.65 g/mol. Its IUPAC name is 3-chloro-N-[(4-hydroxyoxan-4-yl)methyl]-4-iodo-N-methylbenzamide.
| Compound Name | 3-chloro-N-[(4-hydroxyoxan-4-yl)methyl]-4-iodo-N-methylbenzamide |
|---|---|
| PubChem CID | 105341207 |
| Molecular Formula | C14H17ClINO3 |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 3-chloro-N-[(4-hydroxyoxan-4-yl)methyl]-4-iodo-N-methylbenzamide |
| SMILES | CN(CC1(O)CCOCC1)C(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClINO3/c1-17(9-14(19)4-6-20-7-5-14)13(18)10-2-3-12(16)11(15)8-10/h2-3,8,19H,4-7,9H2,1H3 |
| InChIKey | MPYXREZFZFGSNU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|