C14H20ClN3O3 — CID 114953146
2-chloro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methyl-6-(methylamino)pyridine-4-carboxamide (PubChem CID 114953146) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-chloro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methyl-6-(methylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methyl-6-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114953146 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-chloro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methyl-6-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)N(C)CC2(O)CCOCC2)cc(Cl)n1 |
| InChI | InChI=1S/C14H20ClN3O3/c1-16-12-8-10(7-11(15)17-12)13(19)18(2)9-14(20)3-5-21-6-4-14/h7-8,20H,3-6,9H2,1-2H3,(H,16,17) |
| InChIKey | BQPZSDBFNRAAAR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|