C11H10ClF2NO2 — CID 113337541
2-chloro-4,5-difluoro-N-[1-(hydroxymethyl)cyclopropyl]benzamide (PubChem CID 113337541) has the molecular formula C11H10ClF2NO2 and a molecular weight of 261.65 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[1-(hydroxymethyl)cyclopropyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[1-(hydroxymethyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 113337541 |
| Molecular Formula | C11H10ClF2NO2 |
| Molecular Weight | 261.65 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[1-(hydroxymethyl)cyclopropyl]benzamide |
| SMILES | O=C(NC1(CO)CC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C11H10ClF2NO2/c12-7-4-9(14)8(13)3-6(7)10(17)15-11(5-16)1-2-11/h3-4,16H,1-2,5H2,(H,15,17) |
| InChIKey | RZNZPBIWTCVPTK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|